About 5-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-3-carbaldehyde
5-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-3-carbaldehyde (PubChem CID 83862944) has the molecular formula C7H9N3O
and a molecular weight of 151.17 g/mol. Its IUPAC name is 5-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-3-carbaldehyde.
Molecular Properties
| Compound Name | 5-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-3-carbaldehyde |
| PubChem CID | 83862944 |
| Molecular Formula | C7H9N3O |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.07 |
| IUPAC Name | 5-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-3-carbaldehyde |
| SMILES | CN1Cc2[nH]nc(C=O)c2C1 |
| InChI | InChI=1S/C7H9N3O/c1-10-2-5-6(3-10)8-9-7(5)4-11/h4H,2-3H2,1H3,(H,8,9) |
| InChIKey | IXMITDJOAHRLEN-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-3-carbaldehyde?
The IUPAC name of 5-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-3-carbaldehyde (CID 83862944) is 5-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-3-carbaldehyde.
What is the SMILES notation for 5-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-3-carbaldehyde?
The canonical SMILES for 5-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-3-carbaldehyde is CN1Cc2[nH]nc(C=O)c2C1.
What is the InChIKey of 5-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-3-carbaldehyde?
The InChIKey is IXMITDJOAHRLEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O/c1-10-2-5-6(3-10)8-9-7(5)4-11/h4H,2-3H2,1H3,(H,8,9).
What are the key properties of 5-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-3-carbaldehyde?
5-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-3-carbaldehyde has a molecular weight of 151.17 g/mol, XLogP of 0.17, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazole-3-carbaldehyde is sourced from PubChem (CID 83862944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).