About 1-phenyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carbaldehyde
1-phenyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carbaldehyde (PubChem CID 83863030) has the molecular formula C13H12N2O2
and a molecular weight of 228.25 g/mol. Its IUPAC name is 1-phenyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carbaldehyde.
Molecular Properties
| Compound Name | 1-phenyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carbaldehyde |
| PubChem CID | 83863030 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 1-phenyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carbaldehyde |
| SMILES | O=Cc1nn(-c2ccccc2)c2c1COCC2 |
| InChI | InChI=1S/C13H12N2O2/c16-8-12-11-9-17-7-6-13(11)15(14-12)10-4-2-1-3-5-10/h1-5,8H,6-7,9H2 |
| InChIKey | ZEPMYOVZNRLBES-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carbaldehyde?
The IUPAC name of 1-phenyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carbaldehyde (CID 83863030) is 1-phenyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carbaldehyde.
What is the SMILES notation for 1-phenyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carbaldehyde?
The canonical SMILES for 1-phenyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carbaldehyde is O=Cc1nn(-c2ccccc2)c2c1COCC2.
What is the InChIKey of 1-phenyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carbaldehyde?
The InChIKey is ZEPMYOVZNRLBES-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O2/c16-8-12-11-9-17-7-6-13(11)15(14-12)10-4-2-1-3-5-10/h1-5,8H,6-7,9H2.
What are the key properties of 1-phenyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carbaldehyde?
1-phenyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carbaldehyde has a molecular weight of 228.25 g/mol, XLogP of 1.76, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carbaldehyde is sourced from PubChem (CID 83863030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).