C9H15N5 — CID 83863125
4-N,4-N-dimethyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-diamine (PubChem CID 83863125) has the molecular formula C9H15N5 and a molecular weight of 193.25 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N,4-N-dimethyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 83863125 |
| Molecular Formula | C9H15N5 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 4-N,4-N-dimethyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine-2,4-diamine |
| SMILES | CN(C)c1nc(N)nc2c1CCNC2 |
| InChI | InChI=1S/C9H15N5/c1-14(2)8-6-3-4-11-5-7(6)12-9(10)13-8/h11H,3-5H2,1-2H3,(H2,10,12,13) |
| InChIKey | WDTYWUBBSOZRAN-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |