C11H20N4 — CID 83863202
N,N-diethyl-1,4,5,6,7,8-hexahydropyrazolo[4,5-d]azepin-3-amine (PubChem CID 83863202) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is N,N-diethyl-1,4,5,6,7,8-hexahydropyrazolo[4,5-d]azepin-3-amine.
| Compound Name | N,N-diethyl-1,4,5,6,7,8-hexahydropyrazolo[4,5-d]azepin-3-amine |
|---|---|
| PubChem CID | 83863202 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | N,N-diethyl-1,4,5,6,7,8-hexahydropyrazolo[4,5-d]azepin-3-amine |
| SMILES | CCN(CC)c1n[nH]c2c1CCNCC2 |
| InChI | InChI=1S/C11H20N4/c1-3-15(4-2)11-9-5-7-12-8-6-10(9)13-14-11/h12H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | RIZNYWOAPJQOHZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |