C8H11N3O — CID 83863205
1,5,6,7,8,9-hexahydropyrimido[4,5-d]azepin-2-one (PubChem CID 83863205) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is 1,5,6,7,8,9-hexahydropyrimido[4,5-d]azepin-2-one.
| Compound Name | 1,5,6,7,8,9-hexahydropyrimido[4,5-d]azepin-2-one |
|---|---|
| PubChem CID | 83863205 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 1,5,6,7,8,9-hexahydropyrimido[4,5-d]azepin-2-one |
| SMILES | O=c1ncc2c([nH]1)CCNCC2 |
| InChI | InChI=1S/C8H11N3O/c12-8-10-5-6-1-3-9-4-2-7(6)11-8/h5,9H,1-4H2,(H,10,11,12) |
| InChIKey | GNMDVDPYBPEQBT-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |