2-(4-hydroxy-2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetic acid

C10H14N2O3 — CID 83863690

IUPAC2-(4-hydroxy-2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetic acid
SMILESCn1nc2c(c1CC(=O)O)C(O)CCC2
InChIInChI=1S/C10H14N2O3/c1-12-7(5-9(14)15)10-6(11-12)3-2-4-8(10)13/h8,13H,2-5H2,1H3,(H,14,15)
InChIKeyZTDMGQGEFPTZFK-UHFFFAOYSA-N
MW210.23 g/mol
LogP0.42
Rot. Bonds2

About 2-(4-hydroxy-2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetic acid

2-(4-hydroxy-2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetic acid (PubChem CID 83863690) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-(4-hydroxy-2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetic acid.

Molecular Properties

Compound Name2-(4-hydroxy-2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetic acid
PubChem CID83863690
Molecular FormulaC10H14N2O3
Molecular Weight210.23 g/mol
Exact Mass210.10
IUPAC Name2-(4-hydroxy-2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetic acid
SMILESCn1nc2c(c1CC(=O)O)C(O)CCC2
InChIInChI=1S/C10H14N2O3/c1-12-7(5-9(14)15)10-6(11-12)3-2-4-8(10)13/h8,13H,2-5H2,1H3,(H,14,15)
InChIKeyZTDMGQGEFPTZFK-UHFFFAOYSA-N
XLogP0.42
TPSA75.35 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.23
LogP ≤ 50.42
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(4-hydroxy-2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-hydroxy-2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetic acid?
The IUPAC name of 2-(4-hydroxy-2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetic acid (CID 83863690) is 2-(4-hydroxy-2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetic acid.
What is the SMILES notation for 2-(4-hydroxy-2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetic acid?
The canonical SMILES for 2-(4-hydroxy-2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetic acid is Cn1nc2c(c1CC(=O)O)C(O)CCC2.
What is the InChIKey of 2-(4-hydroxy-2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetic acid?
The InChIKey is ZTDMGQGEFPTZFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O3/c1-12-7(5-9(14)15)10-6(11-12)3-2-4-8(10)13/h8,13H,2-5H2,1H3,(H,14,15).
What are the key properties of 2-(4-hydroxy-2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetic acid?
2-(4-hydroxy-2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetic acid has a molecular weight of 210.23 g/mol, XLogP of 0.42, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxy-2-methyl-4,5,6,7-tetrahydroindazol-3-yl)acetic acid is sourced from PubChem (CID 83863690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).