C11H13N3 — CID 83865905
(2-cyclopropylimidazo[1,2-a]pyridin-5-yl)methanamine (PubChem CID 83865905) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is (2-cyclopropylimidazo[1,2-a]pyridin-5-yl)methanamine.
| Compound Name | (2-cyclopropylimidazo[1,2-a]pyridin-5-yl)methanamine |
|---|---|
| PubChem CID | 83865905 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | (2-cyclopropylimidazo[1,2-a]pyridin-5-yl)methanamine |
| SMILES | NCc1cccc2nc(C3CC3)cn12 |
| InChI | InChI=1S/C11H13N3/c12-6-9-2-1-3-11-13-10(7-14(9)11)8-4-5-8/h1-3,7-8H,4-6,12H2 |
| InChIKey | RLBTZFAWTAVFAT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |