C11H20N4 — CID 83866042
[2-(2-methylpropyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methanamine (PubChem CID 83866042) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is [2-(2-methylpropyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methanamine.
| Compound Name | [2-(2-methylpropyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methanamine |
|---|---|
| PubChem CID | 83866042 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | [2-(2-methylpropyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methanamine |
| SMILES | CC(C)Cc1nc2n(n1)CC(CN)CC2 |
| InChI | InChI=1S/C11H20N4/c1-8(2)5-10-13-11-4-3-9(6-12)7-15(11)14-10/h8-9H,3-7,12H2,1-2H3 |
| InChIKey | GAWHVOQBHSBLNP-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |