C8H8F3N3O2 — CID 83866081
2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylic acid (PubChem CID 83866081) has the molecular formula C8H8F3N3O2 and a molecular weight of 235.16 g/mol. Its IUPAC name is 2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylic acid.
| Compound Name | 2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 83866081 |
| Molecular Formula | C8H8F3N3O2 |
| Molecular Weight | 235.16 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-5-carboxylic acid |
| SMILES | O=C(O)C1CCCc2nc(C(F)(F)F)nn21 |
| InChI | InChI=1S/C8H8F3N3O2/c9-8(10,11)7-12-5-3-1-2-4(6(15)16)14(5)13-7/h4H,1-3H2,(H,15,16) |
| InChIKey | SCPUJBKYSGLXKH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.16 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |