About 4-bromo-3-methoxy-1,2-oxazole-5-carboxylic acid
4-bromo-3-methoxy-1,2-oxazole-5-carboxylic acid (PubChem CID 83867102) has the molecular formula C5H4BrNO4
and a molecular weight of 221.99 g/mol. Its IUPAC name is 4-bromo-3-methoxy-1,2-oxazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-bromo-3-methoxy-1,2-oxazole-5-carboxylic acid |
| PubChem CID | 83867102 |
| Molecular Formula | C5H4BrNO4 |
| Molecular Weight | 221.99 g/mol |
| Exact Mass | 220.93 |
| IUPAC Name | 4-bromo-3-methoxy-1,2-oxazole-5-carboxylic acid |
| SMILES | COc1noc(C(=O)O)c1Br |
| InChI | InChI=1S/C5H4BrNO4/c1-10-4-2(6)3(5(8)9)11-7-4/h1H3,(H,8,9) |
| InChIKey | IZOLNARBAPVMQA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.99 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-bromo-3-methoxy-1,2-oxazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3-methoxy-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 4-bromo-3-methoxy-1,2-oxazole-5-carboxylic acid (CID 83867102) is 4-bromo-3-methoxy-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 4-bromo-3-methoxy-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 4-bromo-3-methoxy-1,2-oxazole-5-carboxylic acid is COc1noc(C(=O)O)c1Br.
What is the InChIKey of 4-bromo-3-methoxy-1,2-oxazole-5-carboxylic acid?
The InChIKey is IZOLNARBAPVMQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4BrNO4/c1-10-4-2(6)3(5(8)9)11-7-4/h1H3,(H,8,9).
What are the key properties of 4-bromo-3-methoxy-1,2-oxazole-5-carboxylic acid?
4-bromo-3-methoxy-1,2-oxazole-5-carboxylic acid has a molecular weight of 221.99 g/mol, XLogP of 1.14, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3-methoxy-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 83867102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).