C8H8BrN3 — CID 83867496
1-bromo-7-methylimidazo[1,5-a]pyridin-3-amine (PubChem CID 83867496) has the molecular formula C8H8BrN3 and a molecular weight of 226.08 g/mol. Its IUPAC name is 1-bromo-7-methylimidazo[1,5-a]pyridin-3-amine.
| Compound Name | 1-bromo-7-methylimidazo[1,5-a]pyridin-3-amine |
|---|---|
| PubChem CID | 83867496 |
| Molecular Formula | C8H8BrN3 |
| Molecular Weight | 226.08 g/mol |
| Exact Mass | 224.99 |
| IUPAC Name | 1-bromo-7-methylimidazo[1,5-a]pyridin-3-amine |
| SMILES | Cc1ccn2c(N)nc(Br)c2c1 |
| InChI | InChI=1S/C8H8BrN3/c1-5-2-3-12-6(4-5)7(9)11-8(12)10/h2-4H,1H3,(H2,10,11) |
| InChIKey | CLDTWYQBZMPMOR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.08 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |