C13H17ClN2 — CID 83868417
1-(6-chloro-1,7-dimethylindol-3-yl)-N-methylethanamine (PubChem CID 83868417) has the molecular formula C13H17ClN2 and a molecular weight of 236.75 g/mol. Its IUPAC name is 1-(6-chloro-1,7-dimethylindol-3-yl)-N-methylethanamine.
| Compound Name | 1-(6-chloro-1,7-dimethylindol-3-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 83868417 |
| Molecular Formula | C13H17ClN2 |
| Molecular Weight | 236.75 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 1-(6-chloro-1,7-dimethylindol-3-yl)-N-methylethanamine |
| SMILES | CNC(C)c1cn(C)c2c(C)c(Cl)ccc12 |
| InChI | InChI=1S/C13H17ClN2/c1-8-12(14)6-5-10-11(9(2)15-3)7-16(4)13(8)10/h5-7,9,15H,1-4H3 |
| InChIKey | YNILLSWVVXUBIX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.75 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |