About (4-chloro-7-methyl-2,3-dihydro-1H-indol-2-yl)methanamine
(4-chloro-7-methyl-2,3-dihydro-1H-indol-2-yl)methanamine (PubChem CID 83868565) has the molecular formula C10H13ClN2
and a molecular weight of 196.68 g/mol. Its IUPAC name is (4-chloro-7-methyl-2,3-dihydro-1H-indol-2-yl)methanamine.
Molecular Properties
| Compound Name | (4-chloro-7-methyl-2,3-dihydro-1H-indol-2-yl)methanamine |
| PubChem CID | 83868565 |
| Molecular Formula | C10H13ClN2 |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | (4-chloro-7-methyl-2,3-dihydro-1H-indol-2-yl)methanamine |
| SMILES | Cc1ccc(Cl)c2c1NC(CN)C2 |
| InChI | InChI=1S/C10H13ClN2/c1-6-2-3-9(11)8-4-7(5-12)13-10(6)8/h2-3,7,13H,4-5,12H2,1H3 |
| InChIKey | VETMOGLVDHWJMK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-chloro-7-methyl-2,3-dihydro-1H-indol-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-7-methyl-2,3-dihydro-1H-indol-2-yl)methanamine?
The IUPAC name of (4-chloro-7-methyl-2,3-dihydro-1H-indol-2-yl)methanamine (CID 83868565) is (4-chloro-7-methyl-2,3-dihydro-1H-indol-2-yl)methanamine.
What is the SMILES notation for (4-chloro-7-methyl-2,3-dihydro-1H-indol-2-yl)methanamine?
The canonical SMILES for (4-chloro-7-methyl-2,3-dihydro-1H-indol-2-yl)methanamine is Cc1ccc(Cl)c2c1NC(CN)C2.
What is the InChIKey of (4-chloro-7-methyl-2,3-dihydro-1H-indol-2-yl)methanamine?
The InChIKey is VETMOGLVDHWJMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClN2/c1-6-2-3-9(11)8-4-7(5-12)13-10(6)8/h2-3,7,13H,4-5,12H2,1H3.
What are the key properties of (4-chloro-7-methyl-2,3-dihydro-1H-indol-2-yl)methanamine?
(4-chloro-7-methyl-2,3-dihydro-1H-indol-2-yl)methanamine has a molecular weight of 196.68 g/mol, XLogP of 1.94, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-7-methyl-2,3-dihydro-1H-indol-2-yl)methanamine is sourced from PubChem (CID 83868565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).