About 1-chloro-6-methylimidazo[1,5-a]pyridin-3-amine
1-chloro-6-methylimidazo[1,5-a]pyridin-3-amine (PubChem CID 83869582) has the molecular formula C8H8ClN3
and a molecular weight of 181.63 g/mol. Its IUPAC name is 1-chloro-6-methylimidazo[1,5-a]pyridin-3-amine.
Molecular Properties
| Compound Name | 1-chloro-6-methylimidazo[1,5-a]pyridin-3-amine |
| PubChem CID | 83869582 |
| Molecular Formula | C8H8ClN3 |
| Molecular Weight | 181.63 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 1-chloro-6-methylimidazo[1,5-a]pyridin-3-amine |
| SMILES | Cc1ccc2c(Cl)nc(N)n2c1 |
| InChI | InChI=1S/C8H8ClN3/c1-5-2-3-6-7(9)11-8(10)12(6)4-5/h2-4H,1H3,(H2,10,11) |
| InChIKey | DMSFBFSLAZOMHJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.63 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-chloro-6-methylimidazo[1,5-a]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-6-methylimidazo[1,5-a]pyridin-3-amine?
The IUPAC name of 1-chloro-6-methylimidazo[1,5-a]pyridin-3-amine (CID 83869582) is 1-chloro-6-methylimidazo[1,5-a]pyridin-3-amine.
What is the SMILES notation for 1-chloro-6-methylimidazo[1,5-a]pyridin-3-amine?
The canonical SMILES for 1-chloro-6-methylimidazo[1,5-a]pyridin-3-amine is Cc1ccc2c(Cl)nc(N)n2c1.
What is the InChIKey of 1-chloro-6-methylimidazo[1,5-a]pyridin-3-amine?
The InChIKey is DMSFBFSLAZOMHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClN3/c1-5-2-3-6-7(9)11-8(10)12(6)4-5/h2-4H,1H3,(H2,10,11).
What are the key properties of 1-chloro-6-methylimidazo[1,5-a]pyridin-3-amine?
1-chloro-6-methylimidazo[1,5-a]pyridin-3-amine has a molecular weight of 181.63 g/mol, XLogP of 1.88, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-6-methylimidazo[1,5-a]pyridin-3-amine is sourced from PubChem (CID 83869582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).