C8H8F3N3S — CID 83871269
5-amino-4-(trifluoromethyl)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2-thione (PubChem CID 83871269) has the molecular formula C8H8F3N3S and a molecular weight of 235.23 g/mol. Its IUPAC name is 5-amino-4-(trifluoromethyl)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2-thione.
| Compound Name | 5-amino-4-(trifluoromethyl)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 83871269 |
| Molecular Formula | C8H8F3N3S |
| Molecular Weight | 235.23 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 5-amino-4-(trifluoromethyl)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2-thione |
| SMILES | NC1CCc2[nH]c(=S)nc(C(F)(F)F)c21 |
| InChI | InChI=1S/C8H8F3N3S/c9-8(10,11)6-5-3(12)1-2-4(5)13-7(15)14-6/h3H,1-2,12H2,(H,13,14,15) |
| InChIKey | VKGWJFKLLYZRNJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|