C11H14N2O2S — CID 83871344
7,7-dimethyl-2-sulfanylidene-1,5,6,8-tetrahydroquinazoline-5-carboxylic acid (PubChem CID 83871344) has the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. Its IUPAC name is 7,7-dimethyl-2-sulfanylidene-1,5,6,8-tetrahydroquinazoline-5-carboxylic acid.
| Compound Name | 7,7-dimethyl-2-sulfanylidene-1,5,6,8-tetrahydroquinazoline-5-carboxylic acid |
|---|---|
| PubChem CID | 83871344 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 7,7-dimethyl-2-sulfanylidene-1,5,6,8-tetrahydroquinazoline-5-carboxylic acid |
| SMILES | CC1(C)Cc2[nH]c(=S)ncc2C(C(=O)O)C1 |
| InChI | InChI=1S/C11H14N2O2S/c1-11(2)3-6(9(14)15)7-5-12-10(16)13-8(7)4-11/h5-6H,3-4H2,1-2H3,(H,14,15)(H,12,13,16) |
| InChIKey | FWJGDWWNZQFNQM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|