C8H11N3S — CID 83871383
4-(methylamino)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2-thione (PubChem CID 83871383) has the molecular formula C8H11N3S and a molecular weight of 181.26 g/mol. Its IUPAC name is 4-(methylamino)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2-thione.
| Compound Name | 4-(methylamino)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 83871383 |
| Molecular Formula | C8H11N3S |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 4-(methylamino)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-2-thione |
| SMILES | CNc1nc(=S)[nH]c2c1CCC2 |
| InChI | InChI=1S/C8H11N3S/c1-9-7-5-3-2-4-6(5)10-8(12)11-7/h2-4H2,1H3,(H2,9,10,11,12) |
| InChIKey | RCCNUJDQTPSWOK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|