About 4-(2-aminoethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidine-2-thione
4-(2-aminoethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidine-2-thione (PubChem CID 83871390) has the molecular formula C8H11N3OS
and a molecular weight of 197.26 g/mol. Its IUPAC name is 4-(2-aminoethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidine-2-thione.
Molecular Properties
| Compound Name | 4-(2-aminoethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidine-2-thione |
| PubChem CID | 83871390 |
| Molecular Formula | C8H11N3OS |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 4-(2-aminoethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidine-2-thione |
| SMILES | NCCc1nc(=S)[nH]c2c1COC2 |
| InChI | InChI=1S/C8H11N3OS/c9-2-1-6-5-3-12-4-7(5)11-8(13)10-6/h1-4,9H2,(H,10,11,13) |
| InChIKey | PZXFCLCUYPTBJV-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-aminoethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidine-2-thione?
The IUPAC name of 4-(2-aminoethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidine-2-thione (CID 83871390) is 4-(2-aminoethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidine-2-thione.
What is the SMILES notation for 4-(2-aminoethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidine-2-thione?
The canonical SMILES for 4-(2-aminoethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidine-2-thione is NCCc1nc(=S)[nH]c2c1COC2.
What is the InChIKey of 4-(2-aminoethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidine-2-thione?
The InChIKey is PZXFCLCUYPTBJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3OS/c9-2-1-6-5-3-12-4-7(5)11-8(13)10-6/h1-4,9H2,(H,10,11,13).
What are the key properties of 4-(2-aminoethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidine-2-thione?
4-(2-aminoethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidine-2-thione has a molecular weight of 197.26 g/mol, XLogP of 0.67, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoethyl)-5,7-dihydro-1H-furo[3,4-d]pyrimidine-2-thione is sourced from PubChem (CID 83871390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).