C8H12N4S — CID 83871392
4-(2-aminoethyl)-1,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidine-2-thione (PubChem CID 83871392) has the molecular formula C8H12N4S and a molecular weight of 196.28 g/mol. Its IUPAC name is 4-(2-aminoethyl)-1,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidine-2-thione.
| Compound Name | 4-(2-aminoethyl)-1,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 83871392 |
| Molecular Formula | C8H12N4S |
| Molecular Weight | 196.28 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 4-(2-aminoethyl)-1,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidine-2-thione |
| SMILES | NCCc1nc(=S)[nH]c2c1CNC2 |
| InChI | InChI=1S/C8H12N4S/c9-2-1-6-5-3-10-4-7(5)12-8(13)11-6/h10H,1-4,9H2,(H,11,12,13) |
| InChIKey | NAXLJUYKCIOFCW-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.28 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|