About 2-(6-methyl-2-methylsulfanyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl)ethanamine
2-(6-methyl-2-methylsulfanyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl)ethanamine (PubChem CID 83871417) has the molecular formula C10H16N4S
and a molecular weight of 224.33 g/mol. Its IUPAC name is 2-(6-methyl-2-methylsulfanyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(6-methyl-2-methylsulfanyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl)ethanamine |
| PubChem CID | 83871417 |
| Molecular Formula | C10H16N4S |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 2-(6-methyl-2-methylsulfanyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl)ethanamine |
| SMILES | CSc1nc(CCN)c2c(n1)CN(C)C2 |
| InChI | InChI=1S/C10H16N4S/c1-14-5-7-8(3-4-11)12-10(15-2)13-9(7)6-14/h3-6,11H2,1-2H3 |
| InChIKey | IMCSTMYAJAWZSG-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(6-methyl-2-methylsulfanyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-methyl-2-methylsulfanyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl)ethanamine?
The IUPAC name of 2-(6-methyl-2-methylsulfanyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl)ethanamine (CID 83871417) is 2-(6-methyl-2-methylsulfanyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl)ethanamine.
What is the SMILES notation for 2-(6-methyl-2-methylsulfanyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl)ethanamine?
The canonical SMILES for 2-(6-methyl-2-methylsulfanyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl)ethanamine is CSc1nc(CCN)c2c(n1)CN(C)C2.
What is the InChIKey of 2-(6-methyl-2-methylsulfanyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl)ethanamine?
The InChIKey is IMCSTMYAJAWZSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4S/c1-14-5-7-8(3-4-11)12-10(15-2)13-9(7)6-14/h3-6,11H2,1-2H3.
What are the key properties of 2-(6-methyl-2-methylsulfanyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl)ethanamine?
2-(6-methyl-2-methylsulfanyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl)ethanamine has a molecular weight of 224.33 g/mol, XLogP of 0.65, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methyl-2-methylsulfanyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl)ethanamine is sourced from PubChem (CID 83871417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).