C8H11N3S2 — CID 83871508
4-(methylamino)-1,5,6,8-tetrahydrothiopyrano[3,4-d]pyrimidine-2-thione (PubChem CID 83871508) has the molecular formula C8H11N3S2 and a molecular weight of 213.33 g/mol. Its IUPAC name is 4-(methylamino)-1,5,6,8-tetrahydrothiopyrano[3,4-d]pyrimidine-2-thione.
| Compound Name | 4-(methylamino)-1,5,6,8-tetrahydrothiopyrano[3,4-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 83871508 |
| Molecular Formula | C8H11N3S2 |
| Molecular Weight | 213.33 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | 4-(methylamino)-1,5,6,8-tetrahydrothiopyrano[3,4-d]pyrimidine-2-thione |
| SMILES | CNc1nc(=S)[nH]c2c1CCSC2 |
| InChI | InChI=1S/C8H11N3S2/c1-9-7-5-2-3-13-4-6(5)10-8(12)11-7/h2-4H2,1H3,(H2,9,10,11,12) |
| InChIKey | CNAPVNNNDBGXNO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|