C9H13N3OS — CID 83871607
4-(methylaminomethyl)-1,5,7,8-tetrahydropyrano[4,3-d]pyrimidine-2-thione (PubChem CID 83871607) has the molecular formula C9H13N3OS and a molecular weight of 211.29 g/mol. Its IUPAC name is 4-(methylaminomethyl)-1,5,7,8-tetrahydropyrano[4,3-d]pyrimidine-2-thione.
| Compound Name | 4-(methylaminomethyl)-1,5,7,8-tetrahydropyrano[4,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 83871607 |
| Molecular Formula | C9H13N3OS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 4-(methylaminomethyl)-1,5,7,8-tetrahydropyrano[4,3-d]pyrimidine-2-thione |
| SMILES | CNCc1nc(=S)[nH]c2c1COCC2 |
| InChI | InChI=1S/C9H13N3OS/c1-10-4-8-6-5-13-3-2-7(6)11-9(14)12-8/h10H,2-5H2,1H3,(H,11,12,14) |
| InChIKey | SKTUWKQYJNDUHK-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|