C8H11N3OS — CID 83871611
4-(aminomethyl)-1,5,7,8-tetrahydropyrano[4,3-d]pyrimidine-2-thione (PubChem CID 83871611) has the molecular formula C8H11N3OS and a molecular weight of 197.26 g/mol. Its IUPAC name is 4-(aminomethyl)-1,5,7,8-tetrahydropyrano[4,3-d]pyrimidine-2-thione.
| Compound Name | 4-(aminomethyl)-1,5,7,8-tetrahydropyrano[4,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 83871611 |
| Molecular Formula | C8H11N3OS |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 4-(aminomethyl)-1,5,7,8-tetrahydropyrano[4,3-d]pyrimidine-2-thione |
| SMILES | NCc1nc(=S)[nH]c2c1COCC2 |
| InChI | InChI=1S/C8H11N3OS/c9-3-7-5-4-12-2-1-6(5)10-8(13)11-7/h1-4,9H2,(H,10,11,13) |
| InChIKey | VWOLFSFHSOHRNX-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|