C11H17N3S — CID 83871679
4-(2-aminoethyl)-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-2-thione (PubChem CID 83871679) has the molecular formula C11H17N3S and a molecular weight of 223.34 g/mol. Its IUPAC name is 4-(2-aminoethyl)-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-2-thione.
| Compound Name | 4-(2-aminoethyl)-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 83871679 |
| Molecular Formula | C11H17N3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 4-(2-aminoethyl)-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-2-thione |
| SMILES | NCCc1nc(=S)[nH]c2c1CCCCC2 |
| InChI | InChI=1S/C11H17N3S/c12-7-6-10-8-4-2-1-3-5-9(8)13-11(15)14-10/h1-7,12H2,(H,13,14,15) |
| InChIKey | ZHPHTFIGWGZATG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|