C8H10N2S3 — CID 83871873
4-methylsulfanyl-1,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidine-2-thione (PubChem CID 83871873) has the molecular formula C8H10N2S3 and a molecular weight of 230.38 g/mol. Its IUPAC name is 4-methylsulfanyl-1,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidine-2-thione.
| Compound Name | 4-methylsulfanyl-1,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 83871873 |
| Molecular Formula | C8H10N2S3 |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.00 |
| IUPAC Name | 4-methylsulfanyl-1,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidine-2-thione |
| SMILES | CSc1nc(=S)[nH]c2c1CSCC2 |
| InChI | InChI=1S/C8H10N2S3/c1-12-7-5-4-13-3-2-6(5)9-8(11)10-7/h2-4H2,1H3,(H,9,10,11) |
| InChIKey | QBVOJIJZAAKOHO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|