C9H11N3O2S — CID 83871952
4-amino-2-sulfanylidene-5,6,7,8-tetrahydro-1H-quinazoline-6-carboxylic acid (PubChem CID 83871952) has the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. Its IUPAC name is 4-amino-2-sulfanylidene-5,6,7,8-tetrahydro-1H-quinazoline-6-carboxylic acid.
| Compound Name | 4-amino-2-sulfanylidene-5,6,7,8-tetrahydro-1H-quinazoline-6-carboxylic acid |
|---|---|
| PubChem CID | 83871952 |
| Molecular Formula | C9H11N3O2S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 4-amino-2-sulfanylidene-5,6,7,8-tetrahydro-1H-quinazoline-6-carboxylic acid |
| SMILES | Nc1nc(=S)[nH]c2c1CC(C(=O)O)CC2 |
| InChI | InChI=1S/C9H11N3O2S/c10-7-5-3-4(8(13)14)1-2-6(5)11-9(15)12-7/h4H,1-3H2,(H,13,14)(H3,10,11,12,15) |
| InChIKey | XHUQJAKMNOZMNT-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|