C9H11N3O2S — CID 83872056
6-(cyclopropylamino)-2-methylsulfanylpyrimidine-4-carboxylic acid (PubChem CID 83872056) has the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. Its IUPAC name is 6-(cyclopropylamino)-2-methylsulfanylpyrimidine-4-carboxylic acid.
| Compound Name | 6-(cyclopropylamino)-2-methylsulfanylpyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 83872056 |
| Molecular Formula | C9H11N3O2S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 6-(cyclopropylamino)-2-methylsulfanylpyrimidine-4-carboxylic acid |
| SMILES | CSc1nc(NC2CC2)cc(C(=O)O)n1 |
| InChI | InChI=1S/C9H11N3O2S/c1-15-9-11-6(8(13)14)4-7(12-9)10-5-2-3-5/h4-5H,2-3H2,1H3,(H,13,14)(H,10,11,12) |
| InChIKey | UPPWETVXPLWSGZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |