C8H15N3S — CID 83872167
2-(3a,4,5,6,7,7a-hexahydro-1,2,3-benzothiadiazol-6-yl)ethanamine (PubChem CID 83872167) has the molecular formula C8H15N3S and a molecular weight of 185.30 g/mol. Its IUPAC name is 2-(3a,4,5,6,7,7a-hexahydro-1,2,3-benzothiadiazol-6-yl)ethanamine.
| Compound Name | 2-(3a,4,5,6,7,7a-hexahydro-1,2,3-benzothiadiazol-6-yl)ethanamine |
|---|---|
| PubChem CID | 83872167 |
| Molecular Formula | C8H15N3S |
| Molecular Weight | 185.30 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 2-(3a,4,5,6,7,7a-hexahydro-1,2,3-benzothiadiazol-6-yl)ethanamine |
| SMILES | NCCC1CCC2N=NSC2C1 |
| InChI | InChI=1S/C8H15N3S/c9-4-3-6-1-2-7-8(5-6)12-11-10-7/h6-8H,1-5,9H2 |
| InChIKey | RVUGSXZMNJSGNH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|