About 7,8-dihydro-5H-imidazo[1,5-a]pyridin-6-one
7,8-dihydro-5H-imidazo[1,5-a]pyridin-6-one (PubChem CID 83872238) has the molecular formula C7H8N2O
and a molecular weight of 136.15 g/mol. Its IUPAC name is 7,8-dihydro-5H-imidazo[1,5-a]pyridin-6-one.
Molecular Properties
| Compound Name | 7,8-dihydro-5H-imidazo[1,5-a]pyridin-6-one |
| PubChem CID | 83872238 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | 7,8-dihydro-5H-imidazo[1,5-a]pyridin-6-one |
| SMILES | O=C1CCc2cncn2C1 |
| InChI | InChI=1S/C7H8N2O/c10-7-2-1-6-3-8-5-9(6)4-7/h3,5H,1-2,4H2 |
| InChIKey | QJABUYIVBNGBRD-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7,8-dihydro-5H-imidazo[1,5-a]pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dihydro-5H-imidazo[1,5-a]pyridin-6-one?
The IUPAC name of 7,8-dihydro-5H-imidazo[1,5-a]pyridin-6-one (CID 83872238) is 7,8-dihydro-5H-imidazo[1,5-a]pyridin-6-one.
What is the SMILES notation for 7,8-dihydro-5H-imidazo[1,5-a]pyridin-6-one?
The canonical SMILES for 7,8-dihydro-5H-imidazo[1,5-a]pyridin-6-one is O=C1CCc2cncn2C1.
What is the InChIKey of 7,8-dihydro-5H-imidazo[1,5-a]pyridin-6-one?
The InChIKey is QJABUYIVBNGBRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O/c10-7-2-1-6-3-8-5-9(6)4-7/h3,5H,1-2,4H2.
What are the key properties of 7,8-dihydro-5H-imidazo[1,5-a]pyridin-6-one?
7,8-dihydro-5H-imidazo[1,5-a]pyridin-6-one has a molecular weight of 136.15 g/mol, XLogP of 0.40, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dihydro-5H-imidazo[1,5-a]pyridin-6-one is sourced from PubChem (CID 83872238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).