About 5,6-dihydro-4H-1,2-benzoxazol-7-one
5,6-dihydro-4H-1,2-benzoxazol-7-one (PubChem CID 83872246) has the molecular formula C7H7NO2
and a molecular weight of 137.14 g/mol. Its IUPAC name is 5,6-dihydro-4H-1,2-benzoxazol-7-one.
Molecular Properties
| Compound Name | 5,6-dihydro-4H-1,2-benzoxazol-7-one |
| PubChem CID | 83872246 |
| Molecular Formula | C7H7NO2 |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.05 |
| IUPAC Name | 5,6-dihydro-4H-1,2-benzoxazol-7-one |
| SMILES | O=C1CCCc2cnoc21 |
| InChI | InChI=1S/C7H7NO2/c9-6-3-1-2-5-4-8-10-7(5)6/h4H,1-3H2 |
| InChIKey | SBODGCGSHFVKEK-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,6-dihydro-4H-1,2-benzoxazol-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydro-4H-1,2-benzoxazol-7-one?
The IUPAC name of 5,6-dihydro-4H-1,2-benzoxazol-7-one (CID 83872246) is 5,6-dihydro-4H-1,2-benzoxazol-7-one.
What is the SMILES notation for 5,6-dihydro-4H-1,2-benzoxazol-7-one?
The canonical SMILES for 5,6-dihydro-4H-1,2-benzoxazol-7-one is O=C1CCCc2cnoc21.
What is the InChIKey of 5,6-dihydro-4H-1,2-benzoxazol-7-one?
The InChIKey is SBODGCGSHFVKEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2/c9-6-3-1-2-5-4-8-10-7(5)6/h4H,1-3H2.
What are the key properties of 5,6-dihydro-4H-1,2-benzoxazol-7-one?
5,6-dihydro-4H-1,2-benzoxazol-7-one has a molecular weight of 137.14 g/mol, XLogP of 1.19, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydro-4H-1,2-benzoxazol-7-one is sourced from PubChem (CID 83872246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).