C5H9N5 — CID 83872309
5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-2-amine (PubChem CID 83872309) has the molecular formula C5H9N5 and a molecular weight of 139.16 g/mol. Its IUPAC name is 5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-2-amine.
| Compound Name | 5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-2-amine |
|---|---|
| PubChem CID | 83872309 |
| Molecular Formula | C5H9N5 |
| Molecular Weight | 139.16 g/mol |
| Exact Mass | 139.09 |
| IUPAC Name | 5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-2-amine |
| SMILES | Nc1nc2n(n1)CCNC2 |
| InChI | InChI=1S/C5H9N5/c6-5-8-4-3-7-1-2-10(4)9-5/h7H,1-3H2,(H2,6,9) |
| InChIKey | VMWDAFXSOPGHSJ-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.16 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |