About 4-chloro-N,1-dimethylpyrazol-5-amine
4-chloro-N,1-dimethylpyrazol-5-amine (PubChem CID 83872406) has the molecular formula C5H8ClN3
and a molecular weight of 145.59 g/mol. Its IUPAC name is 4-chloro-N,1-dimethylpyrazol-5-amine.
Molecular Properties
| Compound Name | 4-chloro-N,1-dimethylpyrazol-5-amine |
| PubChem CID | 83872406 |
| Molecular Formula | C5H8ClN3 |
| Molecular Weight | 145.59 g/mol |
| Exact Mass | 145.04 |
| IUPAC Name | 4-chloro-N,1-dimethylpyrazol-5-amine |
| SMILES | CNc1c(Cl)cnn1C |
| InChI | InChI=1S/C5H8ClN3/c1-7-5-4(6)3-8-9(5)2/h3,7H,1-2H3 |
| InChIKey | JIAQRMODODYDEJ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.59 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-N,1-dimethylpyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N,1-dimethylpyrazol-5-amine?
The IUPAC name of 4-chloro-N,1-dimethylpyrazol-5-amine (CID 83872406) is 4-chloro-N,1-dimethylpyrazol-5-amine.
What is the SMILES notation for 4-chloro-N,1-dimethylpyrazol-5-amine?
The canonical SMILES for 4-chloro-N,1-dimethylpyrazol-5-amine is CNc1c(Cl)cnn1C.
What is the InChIKey of 4-chloro-N,1-dimethylpyrazol-5-amine?
The InChIKey is JIAQRMODODYDEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8ClN3/c1-7-5-4(6)3-8-9(5)2/h3,7H,1-2H3.
What are the key properties of 4-chloro-N,1-dimethylpyrazol-5-amine?
4-chloro-N,1-dimethylpyrazol-5-amine has a molecular weight of 145.59 g/mol, XLogP of 1.12, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N,1-dimethylpyrazol-5-amine is sourced from PubChem (CID 83872406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).