About 5-(aminomethyl)-2,3-dimethylpyrimidin-4-one
5-(aminomethyl)-2,3-dimethylpyrimidin-4-one (PubChem CID 83872659) has the molecular formula C7H11N3O
and a molecular weight of 153.18 g/mol. Its IUPAC name is 5-(aminomethyl)-2,3-dimethylpyrimidin-4-one.
Molecular Properties
| Compound Name | 5-(aminomethyl)-2,3-dimethylpyrimidin-4-one |
| PubChem CID | 83872659 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | 5-(aminomethyl)-2,3-dimethylpyrimidin-4-one |
| SMILES | Cc1ncc(CN)c(=O)n1C |
| InChI | InChI=1S/C7H11N3O/c1-5-9-4-6(3-8)7(11)10(5)2/h4H,3,8H2,1-2H3 |
| InChIKey | HJKZZIIWGIGZSU-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(aminomethyl)-2,3-dimethylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(aminomethyl)-2,3-dimethylpyrimidin-4-one?
The IUPAC name of 5-(aminomethyl)-2,3-dimethylpyrimidin-4-one (CID 83872659) is 5-(aminomethyl)-2,3-dimethylpyrimidin-4-one.
What is the SMILES notation for 5-(aminomethyl)-2,3-dimethylpyrimidin-4-one?
The canonical SMILES for 5-(aminomethyl)-2,3-dimethylpyrimidin-4-one is Cc1ncc(CN)c(=O)n1C.
What is the InChIKey of 5-(aminomethyl)-2,3-dimethylpyrimidin-4-one?
The InChIKey is HJKZZIIWGIGZSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O/c1-5-9-4-6(3-8)7(11)10(5)2/h4H,3,8H2,1-2H3.
What are the key properties of 5-(aminomethyl)-2,3-dimethylpyrimidin-4-one?
5-(aminomethyl)-2,3-dimethylpyrimidin-4-one has a molecular weight of 153.18 g/mol, XLogP of -0.45, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(aminomethyl)-2,3-dimethylpyrimidin-4-one is sourced from PubChem (CID 83872659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).