About 2-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-6-amine
2-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-6-amine (PubChem CID 83872768) has the molecular formula C7H10N2S
and a molecular weight of 154.24 g/mol. Its IUPAC name is 2-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-6-amine.
Molecular Properties
| Compound Name | 2-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-6-amine |
| PubChem CID | 83872768 |
| Molecular Formula | C7H10N2S |
| Molecular Weight | 154.24 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 2-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-6-amine |
| SMILES | Cc1nc2c(s1)C(N)CC2 |
| InChI | InChI=1S/C7H10N2S/c1-4-9-6-3-2-5(8)7(6)10-4/h5H,2-3,8H2,1H3 |
| InChIKey | NBRFCJFEFKXDLB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-6-amine?
The IUPAC name of 2-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-6-amine (CID 83872768) is 2-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-6-amine.
What is the SMILES notation for 2-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-6-amine?
The canonical SMILES for 2-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-6-amine is Cc1nc2c(s1)C(N)CC2.
What is the InChIKey of 2-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-6-amine?
The InChIKey is NBRFCJFEFKXDLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2S/c1-4-9-6-3-2-5(8)7(6)10-4/h5H,2-3,8H2,1H3.
What are the key properties of 2-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-6-amine?
2-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-6-amine has a molecular weight of 154.24 g/mol, XLogP of 1.40, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-6-amine is sourced from PubChem (CID 83872768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).