About tetrazolo[1,5-a]pyridine-5-carboximidamide
tetrazolo[1,5-a]pyridine-5-carboximidamide (PubChem CID 83873084) has the molecular formula C6H6N6
and a molecular weight of 162.16 g/mol. Its IUPAC name is tetrazolo[1,5-a]pyridine-5-carboximidamide.
Molecular Properties
| Compound Name | tetrazolo[1,5-a]pyridine-5-carboximidamide |
| PubChem CID | 83873084 |
| Molecular Formula | C6H6N6 |
| Molecular Weight | 162.16 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | tetrazolo[1,5-a]pyridine-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1cccc2nnnn12 |
| InChI | InChI=1S/C6H6N6/c7-6(8)4-2-1-3-5-9-10-11-12(4)5/h1-3H,(H3,7,8) |
| InChIKey | DVBWTTMJJCZLGZ-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.16 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze tetrazolo[1,5-a]pyridine-5-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrazolo[1,5-a]pyridine-5-carboximidamide?
The IUPAC name of tetrazolo[1,5-a]pyridine-5-carboximidamide (CID 83873084) is tetrazolo[1,5-a]pyridine-5-carboximidamide.
What is the SMILES notation for tetrazolo[1,5-a]pyridine-5-carboximidamide?
The canonical SMILES for tetrazolo[1,5-a]pyridine-5-carboximidamide is [H]/N=C(\N)c1cccc2nnnn12.
What is the InChIKey of tetrazolo[1,5-a]pyridine-5-carboximidamide?
The InChIKey is DVBWTTMJJCZLGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N6/c7-6(8)4-2-1-3-5-9-10-11-12(4)5/h1-3H,(H3,7,8).
What are the key properties of tetrazolo[1,5-a]pyridine-5-carboximidamide?
tetrazolo[1,5-a]pyridine-5-carboximidamide has a molecular weight of 162.16 g/mol, XLogP of -0.59, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tetrazolo[1,5-a]pyridine-5-carboximidamide is sourced from PubChem (CID 83873084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).