About (5-fluoroimidazo[1,5-a]pyridin-3-yl)methanamine
(5-fluoroimidazo[1,5-a]pyridin-3-yl)methanamine (PubChem CID 83873253) has the molecular formula C8H8FN3
and a molecular weight of 165.17 g/mol. Its IUPAC name is (5-fluoroimidazo[1,5-a]pyridin-3-yl)methanamine.
Molecular Properties
| Compound Name | (5-fluoroimidazo[1,5-a]pyridin-3-yl)methanamine |
| PubChem CID | 83873253 |
| Molecular Formula | C8H8FN3 |
| Molecular Weight | 165.17 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | (5-fluoroimidazo[1,5-a]pyridin-3-yl)methanamine |
| SMILES | NCc1ncc2cccc(F)n12 |
| InChI | InChI=1S/C8H8FN3/c9-7-3-1-2-6-5-11-8(4-10)12(6)7/h1-3,5H,4,10H2 |
| InChIKey | DKTYEFAXZUKDOW-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.17 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (5-fluoroimidazo[1,5-a]pyridin-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluoroimidazo[1,5-a]pyridin-3-yl)methanamine?
The IUPAC name of (5-fluoroimidazo[1,5-a]pyridin-3-yl)methanamine (CID 83873253) is (5-fluoroimidazo[1,5-a]pyridin-3-yl)methanamine.
What is the SMILES notation for (5-fluoroimidazo[1,5-a]pyridin-3-yl)methanamine?
The canonical SMILES for (5-fluoroimidazo[1,5-a]pyridin-3-yl)methanamine is NCc1ncc2cccc(F)n12.
What is the InChIKey of (5-fluoroimidazo[1,5-a]pyridin-3-yl)methanamine?
The InChIKey is DKTYEFAXZUKDOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8FN3/c9-7-3-1-2-6-5-11-8(4-10)12(6)7/h1-3,5H,4,10H2.
What are the key properties of (5-fluoroimidazo[1,5-a]pyridin-3-yl)methanamine?
(5-fluoroimidazo[1,5-a]pyridin-3-yl)methanamine has a molecular weight of 165.17 g/mol, XLogP of 0.93, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoroimidazo[1,5-a]pyridin-3-yl)methanamine is sourced from PubChem (CID 83873253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).