About 4-(2-amino-1-hydroxyethyl)-1,3-dimethylimidazol-2-one
4-(2-amino-1-hydroxyethyl)-1,3-dimethylimidazol-2-one (PubChem CID 83874088) has the molecular formula C7H13N3O2
and a molecular weight of 171.20 g/mol. Its IUPAC name is 4-(2-amino-1-hydroxyethyl)-1,3-dimethylimidazol-2-one.
Molecular Properties
| Compound Name | 4-(2-amino-1-hydroxyethyl)-1,3-dimethylimidazol-2-one |
| PubChem CID | 83874088 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 4-(2-amino-1-hydroxyethyl)-1,3-dimethylimidazol-2-one |
| SMILES | Cn1cc(C(O)CN)n(C)c1=O |
| InChI | InChI=1S/C7H13N3O2/c1-9-4-5(6(11)3-8)10(2)7(9)12/h4,6,11H,3,8H2,1-2H3 |
| InChIKey | APXMVLUQEQXPEU-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 73.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2-amino-1-hydroxyethyl)-1,3-dimethylimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-amino-1-hydroxyethyl)-1,3-dimethylimidazol-2-one?
The IUPAC name of 4-(2-amino-1-hydroxyethyl)-1,3-dimethylimidazol-2-one (CID 83874088) is 4-(2-amino-1-hydroxyethyl)-1,3-dimethylimidazol-2-one.
What is the SMILES notation for 4-(2-amino-1-hydroxyethyl)-1,3-dimethylimidazol-2-one?
The canonical SMILES for 4-(2-amino-1-hydroxyethyl)-1,3-dimethylimidazol-2-one is Cn1cc(C(O)CN)n(C)c1=O.
What is the InChIKey of 4-(2-amino-1-hydroxyethyl)-1,3-dimethylimidazol-2-one?
The InChIKey is APXMVLUQEQXPEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O2/c1-9-4-5(6(11)3-8)10(2)7(9)12/h4,6,11H,3,8H2,1-2H3.
What are the key properties of 4-(2-amino-1-hydroxyethyl)-1,3-dimethylimidazol-2-one?
4-(2-amino-1-hydroxyethyl)-1,3-dimethylimidazol-2-one has a molecular weight of 171.20 g/mol, XLogP of -1.28, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-amino-1-hydroxyethyl)-1,3-dimethylimidazol-2-one is sourced from PubChem (CID 83874088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).