About 2-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide
2-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 838742) has the molecular formula C10H8FN3OS
and a molecular weight of 237.26 g/mol. Its IUPAC name is 2-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | 2-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide |
| PubChem CID | 838742 |
| Molecular Formula | C10H8FN3OS |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 2-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | Cc1nnc(NC(=O)c2ccccc2F)s1 |
| InChI | InChI=1S/C10H8FN3OS/c1-6-13-14-10(16-6)12-9(15)7-4-2-3-5-8(7)11/h2-5H,1H3,(H,12,14,15) |
| InChIKey | VOCGBNQZWSARTO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide?
The IUPAC name of 2-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide (CID 838742) is 2-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide.
What is the SMILES notation for 2-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide?
The canonical SMILES for 2-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide is Cc1nnc(NC(=O)c2ccccc2F)s1.
What is the InChIKey of 2-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide?
The InChIKey is VOCGBNQZWSARTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8FN3OS/c1-6-13-14-10(16-6)12-9(15)7-4-2-3-5-8(7)11/h2-5H,1H3,(H,12,14,15).
What are the key properties of 2-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide?
2-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide has a molecular weight of 237.26 g/mol, XLogP of 2.24, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzamide is sourced from PubChem (CID 838742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).