C8H11N5 — CID 83874715
1-imidazo[2,1-c][1,2,4]triazin-6-ylpropan-2-amine (PubChem CID 83874715) has the molecular formula C8H11N5 and a molecular weight of 177.21 g/mol. Its IUPAC name is 1-imidazo[2,1-c][1,2,4]triazin-6-ylpropan-2-amine.
| Compound Name | 1-imidazo[2,1-c][1,2,4]triazin-6-ylpropan-2-amine |
|---|---|
| PubChem CID | 83874715 |
| Molecular Formula | C8H11N5 |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 1-imidazo[2,1-c][1,2,4]triazin-6-ylpropan-2-amine |
| SMILES | CC(N)Cc1cnc2nnccn12 |
| InChI | InChI=1S/C8H11N5/c1-6(9)4-7-5-10-8-12-11-2-3-13(7)8/h2-3,5-6H,4,9H2,1H3 |
| InChIKey | YFFXUFMXSRHWGY-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |