About 4-methoxyimidazo[5,1-f][1,2,4]triazine-7-carbaldehyde
4-methoxyimidazo[5,1-f][1,2,4]triazine-7-carbaldehyde (PubChem CID 83874786) has the molecular formula C7H6N4O2
and a molecular weight of 178.15 g/mol. Its IUPAC name is 4-methoxyimidazo[5,1-f][1,2,4]triazine-7-carbaldehyde.
Molecular Properties
| Compound Name | 4-methoxyimidazo[5,1-f][1,2,4]triazine-7-carbaldehyde |
| PubChem CID | 83874786 |
| Molecular Formula | C7H6N4O2 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 4-methoxyimidazo[5,1-f][1,2,4]triazine-7-carbaldehyde |
| SMILES | COc1ncnn2c(C=O)ncc12 |
| InChI | InChI=1S/C7H6N4O2/c1-13-7-5-2-8-6(3-12)11(5)10-4-9-7/h2-4H,1H3 |
| InChIKey | HXMORIMMBFUMSU-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxyimidazo[5,1-f][1,2,4]triazine-7-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxyimidazo[5,1-f][1,2,4]triazine-7-carbaldehyde?
The IUPAC name of 4-methoxyimidazo[5,1-f][1,2,4]triazine-7-carbaldehyde (CID 83874786) is 4-methoxyimidazo[5,1-f][1,2,4]triazine-7-carbaldehyde.
What is the SMILES notation for 4-methoxyimidazo[5,1-f][1,2,4]triazine-7-carbaldehyde?
The canonical SMILES for 4-methoxyimidazo[5,1-f][1,2,4]triazine-7-carbaldehyde is COc1ncnn2c(C=O)ncc12.
What is the InChIKey of 4-methoxyimidazo[5,1-f][1,2,4]triazine-7-carbaldehyde?
The InChIKey is HXMORIMMBFUMSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4O2/c1-13-7-5-2-8-6(3-12)11(5)10-4-9-7/h2-4H,1H3.
What are the key properties of 4-methoxyimidazo[5,1-f][1,2,4]triazine-7-carbaldehyde?
4-methoxyimidazo[5,1-f][1,2,4]triazine-7-carbaldehyde has a molecular weight of 178.15 g/mol, XLogP of -0.05, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxyimidazo[5,1-f][1,2,4]triazine-7-carbaldehyde is sourced from PubChem (CID 83874786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).