2-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)acetic acid

C9H12N2O2 — CID 83875355

IUPAC2-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)acetic acid
SMILESO=C(O)Cc1cnn2c1CCCC2
InChIInChI=1S/C9H12N2O2/c12-9(13)5-7-6-10-11-4-2-1-3-8(7)11/h6H,1-5H2,(H,12,13)
InChIKeySQEXEIFPEAOWMI-UHFFFAOYSA-N
MW180.21 g/mol
LogP0.85
Rot. Bonds2

About 2-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)acetic acid

2-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)acetic acid (PubChem CID 83875355) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 2-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)acetic acid.

Molecular Properties

Compound Name2-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)acetic acid
PubChem CID83875355
Molecular FormulaC9H12N2O2
Molecular Weight180.21 g/mol
Exact Mass180.09
IUPAC Name2-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)acetic acid
SMILESO=C(O)Cc1cnn2c1CCCC2
InChIInChI=1S/C9H12N2O2/c12-9(13)5-7-6-10-11-4-2-1-3-8(7)11/h6H,1-5H2,(H,12,13)
InChIKeySQEXEIFPEAOWMI-UHFFFAOYSA-N
XLogP0.85
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.21
LogP ≤ 50.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)acetic acid?
The IUPAC name of 2-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)acetic acid (CID 83875355) is 2-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)acetic acid.
What is the SMILES notation for 2-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)acetic acid?
The canonical SMILES for 2-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)acetic acid is O=C(O)Cc1cnn2c1CCCC2.
What is the InChIKey of 2-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)acetic acid?
The InChIKey is SQEXEIFPEAOWMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2/c12-9(13)5-7-6-10-11-4-2-1-3-8(7)11/h6H,1-5H2,(H,12,13).
What are the key properties of 2-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)acetic acid?
2-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)acetic acid has a molecular weight of 180.21 g/mol, XLogP of 0.85, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)acetic acid is sourced from PubChem (CID 83875355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).