About 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-6-amine
2-propan-2-yl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-6-amine (PubChem CID 83876157) has the molecular formula C9H14N2S
and a molecular weight of 182.29 g/mol. Its IUPAC name is 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-6-amine.
Molecular Properties
| Compound Name | 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-6-amine |
| PubChem CID | 83876157 |
| Molecular Formula | C9H14N2S |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-6-amine |
| SMILES | CC(C)c1nc2c(s1)C(N)CC2 |
| InChI | InChI=1S/C9H14N2S/c1-5(2)9-11-7-4-3-6(10)8(7)12-9/h5-6H,3-4,10H2,1-2H3 |
| InChIKey | CIGMAKDDAFLAEU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-6-amine?
The IUPAC name of 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-6-amine (CID 83876157) is 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-6-amine.
What is the SMILES notation for 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-6-amine?
The canonical SMILES for 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-6-amine is CC(C)c1nc2c(s1)C(N)CC2.
What is the InChIKey of 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-6-amine?
The InChIKey is CIGMAKDDAFLAEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2S/c1-5(2)9-11-7-4-3-6(10)8(7)12-9/h5-6H,3-4,10H2,1-2H3.
What are the key properties of 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-6-amine?
2-propan-2-yl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-6-amine has a molecular weight of 182.29 g/mol, XLogP of 2.21, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-6-amine is sourced from PubChem (CID 83876157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).