About 4-(methylaminomethyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-amine
4-(methylaminomethyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-amine (PubChem CID 83876316) has the molecular formula C8H13N3S
and a molecular weight of 183.28 g/mol. Its IUPAC name is 4-(methylaminomethyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-amine.
Molecular Properties
| Compound Name | 4-(methylaminomethyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-amine |
| PubChem CID | 83876316 |
| Molecular Formula | C8H13N3S |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 4-(methylaminomethyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-amine |
| SMILES | CNCC1CCc2sc(N)nc21 |
| InChI | InChI=1S/C8H13N3S/c1-10-4-5-2-3-6-7(5)11-8(9)12-6/h5,10H,2-4H2,1H3,(H2,9,11) |
| InChIKey | FKRHGAKOZNIQCS-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(methylaminomethyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(methylaminomethyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-amine?
The IUPAC name of 4-(methylaminomethyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-amine (CID 83876316) is 4-(methylaminomethyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-amine.
What is the SMILES notation for 4-(methylaminomethyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-amine?
The canonical SMILES for 4-(methylaminomethyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-amine is CNCC1CCc2sc(N)nc21.
What is the InChIKey of 4-(methylaminomethyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-amine?
The InChIKey is FKRHGAKOZNIQCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3S/c1-10-4-5-2-3-6-7(5)11-8(9)12-6/h5,10H,2-4H2,1H3,(H2,9,11).
What are the key properties of 4-(methylaminomethyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-amine?
4-(methylaminomethyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-amine has a molecular weight of 183.28 g/mol, XLogP of 0.97, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(methylaminomethyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-amine is sourced from PubChem (CID 83876316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).