C8H14N2OS — CID 83876693
2-(2-ethoxy-1,3-thiazol-4-yl)-N-methylethanamine (PubChem CID 83876693) has the molecular formula C8H14N2OS and a molecular weight of 186.28 g/mol. Its IUPAC name is 2-(2-ethoxy-1,3-thiazol-4-yl)-N-methylethanamine.
| Compound Name | 2-(2-ethoxy-1,3-thiazol-4-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 83876693 |
| Molecular Formula | C8H14N2OS |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 2-(2-ethoxy-1,3-thiazol-4-yl)-N-methylethanamine |
| SMILES | CCOc1nc(CCNC)cs1 |
| InChI | InChI=1S/C8H14N2OS/c1-3-11-8-10-7(6-12-8)4-5-9-2/h6,9H,3-5H2,1-2H3 |
| InChIKey | CRBHKQYEJIZEAJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |