C9H10N4O — CID 83877418
N'-hydroxy-7-methylimidazo[1,2-a]pyridine-2-carboximidamide (PubChem CID 83877418) has the molecular formula C9H10N4O and a molecular weight of 190.21 g/mol. Its IUPAC name is N'-hydroxy-7-methylimidazo[1,2-a]pyridine-2-carboximidamide.
| Compound Name | N'-hydroxy-7-methylimidazo[1,2-a]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 83877418 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | N'-hydroxy-7-methylimidazo[1,2-a]pyridine-2-carboximidamide |
| SMILES | Cc1ccn2cc(/C(N)=N\O)nc2c1 |
| InChI | InChI=1S/C9H10N4O/c1-6-2-3-13-5-7(9(10)12-14)11-8(13)4-6/h2-5,14H,1H3,(H2,10,12) |
| InChIKey | KUOYAKVGRRQNLL-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 75.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|