C10H14N4 — CID 83877578
5-N,5-N,1-trimethylimidazo[1,5-a]pyridine-3,5-diamine (PubChem CID 83877578) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is 5-N,5-N,1-trimethylimidazo[1,5-a]pyridine-3,5-diamine.
| Compound Name | 5-N,5-N,1-trimethylimidazo[1,5-a]pyridine-3,5-diamine |
|---|---|
| PubChem CID | 83877578 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 5-N,5-N,1-trimethylimidazo[1,5-a]pyridine-3,5-diamine |
| SMILES | Cc1nc(N)n2c(N(C)C)cccc12 |
| InChI | InChI=1S/C10H14N4/c1-7-8-5-4-6-9(13(2)3)14(8)10(11)12-7/h4-6H,1-3H3,(H2,11,12) |
| InChIKey | SNVAZRCGZJSBQS-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 46.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |