2-(1-methylbenzotriazol-4-yl)acetic acid

C9H9N3O2 — CID 83877625

IUPAC2-(1-methylbenzotriazol-4-yl)acetic acid
SMILESCn1nnc2c(CC(=O)O)cccc21
InChIInChI=1S/C9H9N3O2/c1-12-7-4-2-3-6(5-8(13)14)9(7)10-11-12/h2-4H,5H2,1H3,(H,13,14)
InChIKeyGVQWWIFOWHYUEJ-UHFFFAOYSA-N
MW191.19 g/mol
LogP0.60
Rot. Bonds2

About 2-(1-methylbenzotriazol-4-yl)acetic acid

2-(1-methylbenzotriazol-4-yl)acetic acid (PubChem CID 83877625) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is 2-(1-methylbenzotriazol-4-yl)acetic acid.

Molecular Properties

Compound Name2-(1-methylbenzotriazol-4-yl)acetic acid
PubChem CID83877625
Molecular FormulaC9H9N3O2
Molecular Weight191.19 g/mol
Exact Mass191.07
IUPAC Name2-(1-methylbenzotriazol-4-yl)acetic acid
SMILESCn1nnc2c(CC(=O)O)cccc21
InChIInChI=1S/C9H9N3O2/c1-12-7-4-2-3-6(5-8(13)14)9(7)10-11-12/h2-4H,5H2,1H3,(H,13,14)
InChIKeyGVQWWIFOWHYUEJ-UHFFFAOYSA-N
XLogP0.60
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500191.19
LogP ≤ 50.60
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(1-methylbenzotriazol-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1-methylbenzotriazol-4-yl)acetic acid?
The IUPAC name of 2-(1-methylbenzotriazol-4-yl)acetic acid (CID 83877625) is 2-(1-methylbenzotriazol-4-yl)acetic acid.
What is the SMILES notation for 2-(1-methylbenzotriazol-4-yl)acetic acid?
The canonical SMILES for 2-(1-methylbenzotriazol-4-yl)acetic acid is Cn1nnc2c(CC(=O)O)cccc21.
What is the InChIKey of 2-(1-methylbenzotriazol-4-yl)acetic acid?
The InChIKey is GVQWWIFOWHYUEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O2/c1-12-7-4-2-3-6(5-8(13)14)9(7)10-11-12/h2-4H,5H2,1H3,(H,13,14).
What are the key properties of 2-(1-methylbenzotriazol-4-yl)acetic acid?
2-(1-methylbenzotriazol-4-yl)acetic acid has a molecular weight of 191.19 g/mol, XLogP of 0.60, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methylbenzotriazol-4-yl)acetic acid is sourced from PubChem (CID 83877625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).