C8H9N5O — CID 83877712
N'-hydroxy-2-([1,2,4]triazolo[1,5-a]pyridin-6-yl)ethanimidamide (PubChem CID 83877712) has the molecular formula C8H9N5O and a molecular weight of 191.19 g/mol. Its IUPAC name is N'-hydroxy-2-([1,2,4]triazolo[1,5-a]pyridin-6-yl)ethanimidamide.
| Compound Name | N'-hydroxy-2-([1,2,4]triazolo[1,5-a]pyridin-6-yl)ethanimidamide |
|---|---|
| PubChem CID | 83877712 |
| Molecular Formula | C8H9N5O |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | N'-hydroxy-2-([1,2,4]triazolo[1,5-a]pyridin-6-yl)ethanimidamide |
| SMILES | N/C(Cc1ccc2ncnn2c1)=N\O |
| InChI | InChI=1S/C8H9N5O/c9-7(12-14)3-6-1-2-8-10-5-11-13(8)4-6/h1-2,4-5,14H,3H2,(H2,9,12) |
| InChIKey | LJTZWVCQXUSXBK-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 88.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|