About (1-nitroimidazo[1,5-a]pyridin-5-yl)methanamine
(1-nitroimidazo[1,5-a]pyridin-5-yl)methanamine (PubChem CID 83877928) has the molecular formula C8H8N4O2
and a molecular weight of 192.18 g/mol. Its IUPAC name is (1-nitroimidazo[1,5-a]pyridin-5-yl)methanamine.
Molecular Properties
| Compound Name | (1-nitroimidazo[1,5-a]pyridin-5-yl)methanamine |
| PubChem CID | 83877928 |
| Molecular Formula | C8H8N4O2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | (1-nitroimidazo[1,5-a]pyridin-5-yl)methanamine |
| SMILES | NCc1cccc2c([N+](=O)[O-])ncn12 |
| InChI | InChI=1S/C8H8N4O2/c9-4-6-2-1-3-7-8(12(13)14)10-5-11(6)7/h1-3,5H,4,9H2 |
| InChIKey | KWMOVHOOKXQTIK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1-nitroimidazo[1,5-a]pyridin-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-nitroimidazo[1,5-a]pyridin-5-yl)methanamine?
The IUPAC name of (1-nitroimidazo[1,5-a]pyridin-5-yl)methanamine (CID 83877928) is (1-nitroimidazo[1,5-a]pyridin-5-yl)methanamine.
What is the SMILES notation for (1-nitroimidazo[1,5-a]pyridin-5-yl)methanamine?
The canonical SMILES for (1-nitroimidazo[1,5-a]pyridin-5-yl)methanamine is NCc1cccc2c([N+](=O)[O-])ncn12.
What is the InChIKey of (1-nitroimidazo[1,5-a]pyridin-5-yl)methanamine?
The InChIKey is KWMOVHOOKXQTIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O2/c9-4-6-2-1-3-7-8(12(13)14)10-5-11(6)7/h1-3,5H,4,9H2.
What are the key properties of (1-nitroimidazo[1,5-a]pyridin-5-yl)methanamine?
(1-nitroimidazo[1,5-a]pyridin-5-yl)methanamine has a molecular weight of 192.18 g/mol, XLogP of 0.70, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-nitroimidazo[1,5-a]pyridin-5-yl)methanamine is sourced from PubChem (CID 83877928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).