2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylic acid

C5H4F3N3O2 — CID 83879209

IUPAC2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylic acid
SMILESCn1nc(C(F)(F)F)nc1C(=O)O
InChIInChI=1S/C5H4F3N3O2/c1-11-2(3(12)13)9-4(10-11)5(6,7)8/h1H3,(H,12,13)
InChIKeyKBTIORFKJVWSAT-UHFFFAOYSA-N
MW195.10 g/mol
LogP0.53
Rot. Bonds1

About 2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylic acid

2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylic acid (PubChem CID 83879209) has the molecular formula C5H4F3N3O2 and a molecular weight of 195.10 g/mol. Its IUPAC name is 2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylic acid.

Molecular Properties

Compound Name2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylic acid
PubChem CID83879209
Molecular FormulaC5H4F3N3O2
Molecular Weight195.10 g/mol
Exact Mass195.03
IUPAC Name2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylic acid
SMILESCn1nc(C(F)(F)F)nc1C(=O)O
InChIInChI=1S/C5H4F3N3O2/c1-11-2(3(12)13)9-4(10-11)5(6,7)8/h1H3,(H,12,13)
InChIKeyKBTIORFKJVWSAT-UHFFFAOYSA-N
XLogP0.53
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.10
LogP ≤ 50.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylic acid?
The IUPAC name of 2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylic acid (CID 83879209) is 2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylic acid.
What is the SMILES notation for 2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylic acid?
The canonical SMILES for 2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylic acid is Cn1nc(C(F)(F)F)nc1C(=O)O.
What is the InChIKey of 2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylic acid?
The InChIKey is KBTIORFKJVWSAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4F3N3O2/c1-11-2(3(12)13)9-4(10-11)5(6,7)8/h1H3,(H,12,13).
What are the key properties of 2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylic acid?
2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylic acid has a molecular weight of 195.10 g/mol, XLogP of 0.53, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylic acid is sourced from PubChem (CID 83879209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).